C17H27NO — CID 71210847
N,N-diethyl-3,5-di(propan-2-yl)benzamide (PubChem CID 71210847) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is N,N-diethyl-3,5-di(propan-2-yl)benzamide.
| Compound Name | N,N-diethyl-3,5-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 71210847 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | N,N-diethyl-3,5-di(propan-2-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C17H27NO/c1-7-18(8-2)17(19)16-10-14(12(3)4)9-15(11-16)13(5)6/h9-13H,7-8H2,1-6H3 |
| InChIKey | SUFUISVVDYKPNA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |