C14H19NO2 — CID 59369544
CID 59369544 (PubChem CID 59369544) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol.
| Compound Name | CID 59369544 |
|---|---|
| PubChem CID | 59369544 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | — |
| SMILES | [CH]c1cc(C(=O)N(CC)CC)cc(C(C)O)c1 |
| InChI | InChI=1S/C14H19NO2/c1-5-15(6-2)14(17)13-8-10(3)7-12(9-13)11(4)16/h3,7-9,11,16H,5-6H2,1-2,4H3 |
| InChIKey | XQFFNHFJPSRFPZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |