C13H16N2O3 — CID 171662742
3-ethenyl-N,N-diethyl-5-nitrobenzamide (PubChem CID 171662742) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-ethenyl-N,N-diethyl-5-nitrobenzamide.
| Compound Name | 3-ethenyl-N,N-diethyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 171662742 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-ethenyl-N,N-diethyl-5-nitrobenzamide |
| SMILES | C=Cc1cc(C(=O)N(CC)CC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O3/c1-4-10-7-11(9-12(8-10)15(17)18)13(16)14(5-2)6-3/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | YTVNIXMSCUTQCL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|