3,5-di(propan-2-yl)benzoic acid

C13H18O2 — CID 11958988

IUPAC3,5-di(propan-2-yl)benzoic acid
SMILESCC(C)c1cc(C(=O)O)cc(C(C)C)c1
InChIInChI=1S/C13H18O2/c1-8(2)10-5-11(9(3)4)7-12(6-10)13(14)15/h5-9H,1-4H3,(H,14,15)
InChIKeyATZYXOARJYNLLG-UHFFFAOYSA-N
MW206.28 g/mol
LogP3.63
Rot. Bonds3

About 3,5-di(propan-2-yl)benzoic acid

3,5-di(propan-2-yl)benzoic acid (PubChem CID 11958988) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)benzoic acid.

Molecular Properties

Compound Name3,5-di(propan-2-yl)benzoic acid
PubChem CID11958988
Molecular FormulaC13H18O2
Molecular Weight206.28 g/mol
Exact Mass206.13
IUPAC Name3,5-di(propan-2-yl)benzoic acid
SMILESCC(C)c1cc(C(=O)O)cc(C(C)C)c1
InChIInChI=1S/C13H18O2/c1-8(2)10-5-11(9(3)4)7-12(6-10)13(14)15/h5-9H,1-4H3,(H,14,15)
InChIKeyATZYXOARJYNLLG-UHFFFAOYSA-N
XLogP3.63
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.28
LogP ≤ 53.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3,5-di(propan-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-di(propan-2-yl)benzoic acid?
The IUPAC name of 3,5-di(propan-2-yl)benzoic acid (CID 11958988) is 3,5-di(propan-2-yl)benzoic acid.
What is the SMILES notation for 3,5-di(propan-2-yl)benzoic acid?
The canonical SMILES for 3,5-di(propan-2-yl)benzoic acid is CC(C)c1cc(C(=O)O)cc(C(C)C)c1.
What is the InChIKey of 3,5-di(propan-2-yl)benzoic acid?
The InChIKey is ATZYXOARJYNLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-8(2)10-5-11(9(3)4)7-12(6-10)13(14)15/h5-9H,1-4H3,(H,14,15).
What are the key properties of 3,5-di(propan-2-yl)benzoic acid?
3,5-di(propan-2-yl)benzoic acid has a molecular weight of 206.28 g/mol, XLogP of 3.63, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(propan-2-yl)benzoic acid is sourced from PubChem (CID 11958988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).