C13H18O3 — CID 175573389
3,5-di(propan-2-yl)benzenecarboperoxoic acid (PubChem CID 175573389) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)benzenecarboperoxoic acid.
| Compound Name | 3,5-di(propan-2-yl)benzenecarboperoxoic acid |
|---|---|
| PubChem CID | 175573389 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3,5-di(propan-2-yl)benzenecarboperoxoic acid |
| SMILES | CC(C)c1cc(C(=O)OO)cc(C(C)C)c1 |
| InChI | InChI=1S/C13H18O3/c1-8(2)10-5-11(9(3)4)7-12(6-10)13(14)16-15/h5-9,15H,1-4H3 |
| InChIKey | AFWNLXUOHAVXCO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|