C16H19F5O5S — CID 129070078
2-[3,5-di(propan-2-yl)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 129070078) has the molecular formula C16H19F5O5S and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-[3,5-di(propan-2-yl)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[3,5-di(propan-2-yl)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070078 |
| Molecular Formula | C16H19F5O5S |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-[3,5-di(propan-2-yl)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | CC(C)c1cc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)cc(C(C)C)c1 |
| InChI | InChI=1S/C16H19F5O5S/c1-8(2)10-5-11(9(3)4)7-12(6-10)13(22)26-14(15(17,18)19)16(20,21)27(23,24)25/h5-9,14H,1-4H3,(H,23,24,25) |
| InChIKey | VKZPEHGRSYSYKL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|