C10H4F5I3O5S — CID 155135734
1,1,3,3,3-pentafluoro-2-(2,3,5-triiodobenzoyl)oxypropane-1-sulfonic acid (PubChem CID 155135734) has the molecular formula C10H4F5I3O5S and a molecular weight of 711.91 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(2,3,5-triiodobenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(2,3,5-triiodobenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 155135734 |
| Molecular Formula | C10H4F5I3O5S |
| Molecular Weight | 711.91 g/mol |
| Exact Mass | 711.68 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(2,3,5-triiodobenzoyl)oxypropane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C10H4F5I3O5S/c11-9(12,13)8(10(14,15)24(20,21)22)23-7(19)4-1-3(16)2-5(17)6(4)18/h1-2,8H,(H,20,21,22) |
| InChIKey | LANJZOIILLIVQH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|