C18H18F5IO8S — CID 170402093
1,1,3,3,3-pentafluoro-2-[5-iodo-2-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxypropane-1-sulfonic acid (PubChem CID 170402093) has the molecular formula C18H18F5IO8S and a molecular weight of 616.30 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[5-iodo-2-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[5-iodo-2-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 170402093 |
| Molecular Formula | C18H18F5IO8S |
| Molecular Weight | 616.30 g/mol |
| Exact Mass | 615.97 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[5-iodo-2-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxypropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCCCOc1ccc(I)cc1C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H18F5IO8S/c1-10(2)14(25)31-8-4-3-7-30-13-6-5-11(24)9-12(13)15(26)32-16(17(19,20)21)18(22,23)33(27,28)29/h5-6,9,16H,1,3-4,7-8H2,2H3,(H,27,28,29) |
| InChIKey | YGLSFCUROKAWEA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|