C15H15F2IO8S — CID 170402074
1,1-difluoro-2-[3-iodo-4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxyethanesulfonic acid (PubChem CID 170402074) has the molecular formula C15H15F2IO8S and a molecular weight of 520.24 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-iodo-4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-iodo-4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 170402074 |
| Molecular Formula | C15H15F2IO8S |
| Molecular Weight | 520.24 g/mol |
| Exact Mass | 519.95 |
| IUPAC Name | 1,1-difluoro-2-[3-iodo-4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxyethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(=O)OCC(F)(F)S(=O)(=O)O)cc1I |
| InChI | InChI=1S/C15H15F2IO8S/c1-9(2)13(19)25-6-5-24-12-4-3-10(7-11(12)18)14(20)26-8-15(16,17)27(21,22)23/h3-4,7H,1,5-6,8H2,2H3,(H,21,22,23) |
| InChIKey | ZZSLXEJASKFDIB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|