C10H9F2IO5S — CID 176808014
1,1-difluoro-2-(3-iodo-4-methylbenzoyl)oxyethanesulfonic acid (PubChem CID 176808014) has the molecular formula C10H9F2IO5S and a molecular weight of 406.14 g/mol. Its IUPAC name is 1,1-difluoro-2-(3-iodo-4-methylbenzoyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(3-iodo-4-methylbenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 176808014 |
| Molecular Formula | C10H9F2IO5S |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 1,1-difluoro-2-(3-iodo-4-methylbenzoyl)oxyethanesulfonic acid |
| SMILES | Cc1ccc(C(=O)OCC(F)(F)S(=O)(=O)O)cc1I |
| InChI | InChI=1S/C10H9F2IO5S/c1-6-2-3-7(4-8(6)13)9(14)18-5-10(11,12)19(15,16)17/h2-4H,5H2,1H3,(H,15,16,17) |
| InChIKey | KWHVFZPOOKJUKU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|