C15H12F2O6S — CID 164777509
1,1-difluoro-2-[6-(oxiran-2-yl)naphthalene-2-carbonyl]oxyethanesulfonic acid (PubChem CID 164777509) has the molecular formula C15H12F2O6S and a molecular weight of 358.32 g/mol. Its IUPAC name is 1,1-difluoro-2-[6-(oxiran-2-yl)naphthalene-2-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[6-(oxiran-2-yl)naphthalene-2-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 164777509 |
| Molecular Formula | C15H12F2O6S |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 1,1-difluoro-2-[6-(oxiran-2-yl)naphthalene-2-carbonyl]oxyethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1ccc2cc(C3CO3)ccc2c1 |
| InChI | InChI=1S/C15H12F2O6S/c16-15(17,24(19,20)21)8-23-14(18)12-4-2-9-5-11(13-7-22-13)3-1-10(9)6-12/h1-6,13H,7-8H2,(H,19,20,21) |
| InChIKey | BNGPPSVGMJTJRE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|