C16H11F2IN2O9S — CID 166044239
2-[5-(4-amino-3-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 166044239) has the molecular formula C16H11F2IN2O9S and a molecular weight of 572.24 g/mol. Its IUPAC name is 2-[5-(4-amino-3-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[5-(4-amino-3-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 166044239 |
| Molecular Formula | C16H11F2IN2O9S |
| Molecular Weight | 572.24 g/mol |
| Exact Mass | 571.92 |
| IUPAC Name | 2-[5-(4-amino-3-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | Nc1ccc(C(=O)Oc2ccc([N+](=O)[O-])c(C(=O)OCC(F)(F)S(=O)(=O)O)c2)cc1I |
| InChI | InChI=1S/C16H11F2IN2O9S/c17-16(18,31(26,27)28)7-29-15(23)10-6-9(2-4-13(10)21(24)25)30-14(22)8-1-3-12(20)11(19)5-8/h1-6H,7,20H2,(H,26,27,28) |
| InChIKey | NTTIPQDXLVONSC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 176.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|