C17H11F2INO10S- — CID 166044231
1,1-difluoro-2-[5-(4-iodo-3-methoxybenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate (PubChem CID 166044231) has the molecular formula C17H11F2INO10S- and a molecular weight of 586.24 g/mol. Its IUPAC name is 1,1-difluoro-2-[5-(4-iodo-3-methoxybenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[5-(4-iodo-3-methoxybenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 166044231 |
| Molecular Formula | C17H11F2INO10S- |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 585.91 |
| IUPAC Name | 1,1-difluoro-2-[5-(4-iodo-3-methoxybenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate |
| SMILES | COc1cc(C(=O)Oc2ccc([N+](=O)[O-])c(C(=O)OCC(F)(F)S(=O)(=O)[O-])c2)ccc1I |
| InChI | InChI=1S/C17H12F2INO10S/c1-29-14-6-9(2-4-12(14)20)15(22)31-10-3-5-13(21(24)25)11(7-10)16(23)30-8-17(18,19)32(26,27)28/h2-7H,8H2,1H3,(H,26,27,28)/p-1 |
| InChIKey | XJGWRBSFPRHIJC-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 162.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|