C22H17F2I3N3O11S- — CID 166044236
2-[5-[3,5-bis[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 166044236) has the molecular formula C22H17F2I3N3O11S- and a molecular weight of 950.16 g/mol. Its IUPAC name is 2-[5-[3,5-bis[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[5-[3,5-bis[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 166044236 |
| Molecular Formula | C22H17F2I3N3O11S- |
| Molecular Weight | 950.16 g/mol |
| Exact Mass | 949.77 |
| IUPAC Name | 2-[5-[3,5-bis[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | CC(=O)N(C)c1c(I)c(C(=O)Oc2ccc([N+](=O)[O-])c(C(=O)OCC(F)(F)S(=O)(=O)[O-])c2)c(I)c(N(C)C(C)=O)c1I |
| InChI | InChI=1S/C22H18F2I3N3O11S/c1-9(31)28(3)18-15(25)14(16(26)19(17(18)27)29(4)10(2)32)21(34)41-11-5-6-13(30(35)36)12(7-11)20(33)40-8-22(23,24)42(37,38)39/h5-7H,8H2,1-4H3,(H,37,38,39)/p-1 |
| InChIKey | UBDDZNYNTWFZMA-UHFFFAOYSA-M |
| XLogP | 3.89 |
| TPSA | 193.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.16 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|