C16H8F2I2NO10S- — CID 166044355
1,1-difluoro-2-[5-(2-hydroxy-3,5-diiodobenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate (PubChem CID 166044355) has the molecular formula C16H8F2I2NO10S- and a molecular weight of 698.11 g/mol. Its IUPAC name is 1,1-difluoro-2-[5-(2-hydroxy-3,5-diiodobenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[5-(2-hydroxy-3,5-diiodobenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 166044355 |
| Molecular Formula | C16H8F2I2NO10S- |
| Molecular Weight | 698.11 g/mol |
| Exact Mass | 697.79 |
| IUPAC Name | 1,1-difluoro-2-[5-(2-hydroxy-3,5-diiodobenzoyl)oxy-2-nitrobenzoyl]oxyethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])c1cc(OC(=O)c2cc(I)cc(I)c2O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9F2I2NO10S/c17-16(18,32(27,28)29)6-30-14(23)9-5-8(1-2-12(9)21(25)26)31-15(24)10-3-7(19)4-11(20)13(10)22/h1-5,22H,6H2,(H,27,28,29)/p-1 |
| InChIKey | REJWELJQMLTRSW-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 173.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|