C16H9ClF2INO9S — CID 166044394
2-[5-(2-chloro-4-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 166044394) has the molecular formula C16H9ClF2INO9S and a molecular weight of 591.67 g/mol. Its IUPAC name is 2-[5-(2-chloro-4-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[5-(2-chloro-4-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 166044394 |
| Molecular Formula | C16H9ClF2INO9S |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 590.87 |
| IUPAC Name | 2-[5-(2-chloro-4-iodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])c(C(=O)OCC(F)(F)S(=O)(=O)O)c1)c1ccc(I)cc1Cl |
| InChI | InChI=1S/C16H9ClF2INO9S/c17-12-5-8(20)1-3-10(12)15(23)30-9-2-4-13(21(24)25)11(6-9)14(22)29-7-16(18,19)31(26,27)28/h1-6H,7H2,(H,26,27,28) |
| InChIKey | MUOKKROIGMFFCV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|