C20H14F2I3N3O11S — CID 166044249
2-[5-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 166044249) has the molecular formula C20H14F2I3N3O11S and a molecular weight of 923.12 g/mol. Its IUPAC name is 2-[5-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[5-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 166044249 |
| Molecular Formula | C20H14F2I3N3O11S |
| Molecular Weight | 923.12 g/mol |
| Exact Mass | 922.75 |
| IUPAC Name | 2-[5-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)Oc2ccc([N+](=O)[O-])c(C(=O)OCC(F)(F)S(=O)(=O)O)c2)c1I |
| InChI | InChI=1S/C20H14F2I3N3O11S/c1-7(29)26-16-13(23)12(14(24)17(15(16)25)27-8(2)30)19(32)39-9-3-4-11(28(33)34)10(5-9)18(31)38-6-20(21,22)40(35,36)37/h3-5H,6H2,1-2H3,(H,26,29)(H,27,30)(H,35,36,37) |
| InChIKey | GZBLEHSEOZTWDP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 208.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|