C16H6F2I4NO9S- — CID 166044348
1,1-difluoro-2-[2-nitro-5-(2,3,5,6-tetraiodobenzoyl)oxybenzoyl]oxyethanesulfonate (PubChem CID 166044348) has the molecular formula C16H6F2I4NO9S- and a molecular weight of 933.90 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-nitro-5-(2,3,5,6-tetraiodobenzoyl)oxybenzoyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[2-nitro-5-(2,3,5,6-tetraiodobenzoyl)oxybenzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 166044348 |
| Molecular Formula | C16H6F2I4NO9S- |
| Molecular Weight | 933.90 g/mol |
| Exact Mass | 933.59 |
| IUPAC Name | 1,1-difluoro-2-[2-nitro-5-(2,3,5,6-tetraiodobenzoyl)oxybenzoyl]oxyethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])c1cc(OC(=O)c2c(I)c(I)cc(I)c2I)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H7F2I4NO9S/c17-16(18,33(28,29)30)5-31-14(24)7-3-6(1-2-10(7)23(26)27)32-15(25)11-12(21)8(19)4-9(20)13(11)22/h1-4H,5H2,(H,28,29,30)/p-1 |
| InChIKey | VUUZVEXPJLYSQW-UHFFFAOYSA-M |
| XLogP | 4.53 |
| TPSA | 152.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|