C21H16F2I3N3O11S — CID 166044277
2-[5-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 166044277) has the molecular formula C21H16F2I3N3O11S and a molecular weight of 937.14 g/mol. Its IUPAC name is 2-[5-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[5-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 166044277 |
| Molecular Formula | C21H16F2I3N3O11S |
| Molecular Weight | 937.14 g/mol |
| Exact Mass | 936.76 |
| IUPAC Name | 2-[5-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxy-2-nitrobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC(=O)Nc1c(I)c(C(=O)Oc2ccc([N+](=O)[O-])c(C(=O)OCC(F)(F)S(=O)(=O)O)c2)c(I)c(N(C)C(C)=O)c1I |
| InChI | InChI=1S/C21H16F2I3N3O11S/c1-8(30)27-17-14(24)13(15(25)18(16(17)26)28(3)9(2)31)20(33)40-10-4-5-12(29(34)35)11(6-10)19(32)39-7-21(22,23)41(36,37)38/h4-6H,7H2,1-3H3,(H,27,30)(H,36,37,38) |
| InChIKey | QPHCGIISXBEKMY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 199.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.14 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|