C23H9F2I6O9S- — CID 140828227
2-[2,4-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 140828227) has the molecular formula C23H9F2I6O9S- and a molecular weight of 1260.80 g/mol. Its IUPAC name is 2-[2,4-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[2,4-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 140828227 |
| Molecular Formula | C23H9F2I6O9S- |
| Molecular Weight | 1260.80 g/mol |
| Exact Mass | 1260.42 |
| IUPAC Name | 2-[2,4-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])c1ccc(OC(=O)c2cc(I)cc(I)c2I)cc1OC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C23H10F2I6O9S/c24-23(25,41(35,36)37)8-38-20(32)12-2-1-11(39-21(33)13-3-9(26)5-15(28)18(13)30)7-17(12)40-22(34)14-4-10(27)6-16(29)19(14)31/h1-7H,8H2,(H,35,36,37)/p-1 |
| InChIKey | WOGWWGBWLSDYDN-UHFFFAOYSA-M |
| XLogP | 7.05 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1260.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|