C18H11F2I2O8S- — CID 177295117
2-[2-(5-ethenyl-2-hydroxybenzoyl)oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 177295117) has the molecular formula C18H11F2I2O8S- and a molecular weight of 679.15 g/mol. Its IUPAC name is 2-[2-(5-ethenyl-2-hydroxybenzoyl)oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[2-(5-ethenyl-2-hydroxybenzoyl)oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 177295117 |
| Molecular Formula | C18H11F2I2O8S- |
| Molecular Weight | 679.15 g/mol |
| Exact Mass | 678.82 |
| IUPAC Name | 2-[2-(5-ethenyl-2-hydroxybenzoyl)oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | C=Cc1ccc(O)c(C(=O)Oc2c(I)cc(I)cc2C(=O)OCC(F)(F)S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C18H12F2I2O8S/c1-2-9-3-4-14(23)11(5-9)17(25)30-15-12(6-10(21)7-13(15)22)16(24)29-8-18(19,20)31(26,27)28/h2-7,23H,1,8H2,(H,26,27,28)/p-1 |
| InChIKey | ISQKPYOXTRHGOP-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.15 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|