C19H16F2I2O7S — CID 176765857
2-[4-[2-(4-ethenylphenoxy)ethoxy]-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 176765857) has the molecular formula C19H16F2I2O7S and a molecular weight of 680.20 g/mol. Its IUPAC name is 2-[4-[2-(4-ethenylphenoxy)ethoxy]-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-[2-(4-ethenylphenoxy)ethoxy]-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 176765857 |
| Molecular Formula | C19H16F2I2O7S |
| Molecular Weight | 680.20 g/mol |
| Exact Mass | 679.87 |
| IUPAC Name | 2-[4-[2-(4-ethenylphenoxy)ethoxy]-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | C=Cc1ccc(OCCOc2c(I)cc(C(=O)OCC(F)(F)S(=O)(=O)O)cc2I)cc1 |
| InChI | InChI=1S/C19H16F2I2O7S/c1-2-12-3-5-14(6-4-12)28-7-8-29-17-15(22)9-13(10-16(17)23)18(24)30-11-19(20,21)31(25,26)27/h2-6,9-10H,1,7-8,11H2,(H,25,26,27) |
| InChIKey | TWNLQUCWAKPINI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.20 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|