C12H10F2O7S — CID 59283736
1,1-difluoro-2-(3-prop-2-enoyloxybenzoyl)oxyethanesulfonic acid (PubChem CID 59283736) has the molecular formula C12H10F2O7S and a molecular weight of 336.27 g/mol. Its IUPAC name is 1,1-difluoro-2-(3-prop-2-enoyloxybenzoyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(3-prop-2-enoyloxybenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 59283736 |
| Molecular Formula | C12H10F2O7S |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 1,1-difluoro-2-(3-prop-2-enoyloxybenzoyl)oxyethanesulfonic acid |
| SMILES | C=CC(=O)Oc1cccc(C(=O)OCC(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H10F2O7S/c1-2-10(15)21-9-5-3-4-8(6-9)11(16)20-7-12(13,14)22(17,18)19/h2-6H,1,7H2,(H,17,18,19) |
| InChIKey | QXGQGHPTHFPFFE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|