C14H14F6O7S2 — CID 58364017
3-[3-(4-ethenylphenoxy)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 58364017) has the molecular formula C14H14F6O7S2 and a molecular weight of 472.38 g/mol. Its IUPAC name is 3-[3-(4-ethenylphenoxy)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[3-(4-ethenylphenoxy)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58364017 |
| Molecular Formula | C14H14F6O7S2 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 3-[3-(4-ethenylphenoxy)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc(OCCCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H14F6O7S2/c1-2-10-4-6-11(7-5-10)26-8-3-9-27-29(24,25)14(19,20)12(15,16)13(17,18)28(21,22)23/h2,4-7H,1,3,8-9H2,(H,21,22,23) |
| InChIKey | FQQUNCLHQOSIJD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|