C12H10F6O6S2 — CID 142285898
1-O-(4-ethenylphenyl) 3-O-methyl 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate (PubChem CID 142285898) has the molecular formula C12H10F6O6S2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 1-O-(4-ethenylphenyl) 3-O-methyl 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate.
| Compound Name | 1-O-(4-ethenylphenyl) 3-O-methyl 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate |
|---|---|
| PubChem CID | 142285898 |
| Molecular Formula | C12H10F6O6S2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 1-O-(4-ethenylphenyl) 3-O-methyl 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate |
| SMILES | C=Cc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)OC)cc1 |
| InChI | InChI=1S/C12H10F6O6S2/c1-3-8-4-6-9(7-5-8)24-26(21,22)12(17,18)10(13,14)11(15,16)25(19,20)23-2/h3-7H,1H2,2H3 |
| InChIKey | CHNHPCHDYJKXLD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|