About (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete
(4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete (PubChem CID 87938229) has the molecular formula C12H11F3O4S
and a molecular weight of 308.28 g/mol. Its IUPAC name is (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete.
Molecular Properties
| Compound Name | (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete |
| PubChem CID | 87938229 |
| Molecular Formula | C12H11F3O4S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete |
| SMILES | C1=COC1.C=Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3O3S.C3H4O/c1-2-7-3-5-8(6-4-7)15-16(13,14)9(10,11)12;1-2-4-3-1/h2-6H,1H2;1-2H,3H2 |
| InChIKey | ALPSBYZFEJGCKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete?
The IUPAC name of (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete (CID 87938229) is (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete.
What is the SMILES notation for (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete?
The canonical SMILES for (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete is C1=COC1.C=Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete?
The InChIKey is ALPSBYZFEJGCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O3S.C3H4O/c1-2-7-3-5-8(6-4-7)15-16(13,14)9(10,11)12;1-2-4-3-1/h2-6H,1H2;1-2H,3H2.
What are the key properties of (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete?
(4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete has a molecular weight of 308.28 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl) trifluoromethanesulfonate;2H-oxete is sourced from PubChem (CID 87938229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).