C17H12F6O5S — CID 89483805
4-[3-(4-ethenylphenoxy)-1,1,2,2,3,3-hexafluoropropoxy]benzenesulfonic acid (PubChem CID 89483805) has the molecular formula C17H12F6O5S and a molecular weight of 442.33 g/mol. Its IUPAC name is 4-[3-(4-ethenylphenoxy)-1,1,2,2,3,3-hexafluoropropoxy]benzenesulfonic acid.
| Compound Name | 4-[3-(4-ethenylphenoxy)-1,1,2,2,3,3-hexafluoropropoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 89483805 |
| Molecular Formula | C17H12F6O5S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-[3-(4-ethenylphenoxy)-1,1,2,2,3,3-hexafluoropropoxy]benzenesulfonic acid |
| SMILES | C=Cc1ccc(OC(F)(F)C(F)(F)C(F)(F)Oc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H12F6O5S/c1-2-11-3-5-12(6-4-11)27-16(20,21)15(18,19)17(22,23)28-13-7-9-14(10-8-13)29(24,25)26/h2-10H,1H2,(H,24,25,26) |
| InChIKey | SIVTXBVKHXLFKX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|