C8H8FNO4S2 — CID 20705403
1-ethenyl-4-[(fluoro-hydroxy-oxo-λ6-sulfanylidene)amino]sulfonylbenzene (PubChem CID 20705403) has the molecular formula C8H8FNO4S2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-ethenyl-4-[(fluoro-hydroxy-oxo-λ6-sulfanylidene)amino]sulfonylbenzene.
| Compound Name | 1-ethenyl-4-[(fluoro-hydroxy-oxo-λ6-sulfanylidene)amino]sulfonylbenzene |
|---|---|
| PubChem CID | 20705403 |
| Molecular Formula | C8H8FNO4S2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1-ethenyl-4-[(fluoro-hydroxy-oxo-λ6-sulfanylidene)amino]sulfonylbenzene |
| SMILES | C=Cc1ccc(S(=O)(=O)N=S(=O)(O)F)cc1 |
| InChI | InChI=1S/C8H8FNO4S2/c1-2-7-3-5-8(6-4-7)15(11,12)10-16(9,13)14/h2-6H,1H2,(H,10,13,14) |
| InChIKey | QQGXPNUOVPRTCF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |