C10H8F6O6S2 — CID 58364139
1,1,2,2,3,3-hexafluoro-3-(4-methylphenoxy)sulfonylpropane-1-sulfonic acid (PubChem CID 58364139) has the molecular formula C10H8F6O6S2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(4-methylphenoxy)sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(4-methylphenoxy)sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58364139 |
| Molecular Formula | C10H8F6O6S2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(4-methylphenoxy)sulfonylpropane-1-sulfonic acid |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H8F6O6S2/c1-6-2-4-7(5-3-6)22-24(20,21)10(15,16)8(11,12)9(13,14)23(17,18)19/h2-5H,1H3,(H,17,18,19) |
| InChIKey | RIUOTRDUJBVOAY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|