C17H22F6O6S2 — CID 59833693
3-(3,5-ditert-butylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 59833693) has the molecular formula C17H22F6O6S2 and a molecular weight of 500.48 g/mol. Its IUPAC name is 3-(3,5-ditert-butylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-(3,5-ditert-butylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 59833693 |
| Molecular Formula | C17H22F6O6S2 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 3-(3,5-ditert-butylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CC(C)(C)c1cc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H22F6O6S2/c1-13(2,3)10-7-11(14(4,5)6)9-12(8-10)29-31(27,28)17(22,23)15(18,19)16(20,21)30(24,25)26/h7-9H,1-6H3,(H,24,25,26) |
| InChIKey | JROCHECCLGBFEE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|