C10H9F6NO6S2 — CID 126656761
1,1,2,2,3,3-hexafluoro-3-[3-(methylamino)phenoxy]sulfonylpropane-1-sulfonic acid (PubChem CID 126656761) has the molecular formula C10H9F6NO6S2 and a molecular weight of 417.31 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[3-(methylamino)phenoxy]sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[3-(methylamino)phenoxy]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 126656761 |
| Molecular Formula | C10H9F6NO6S2 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[3-(methylamino)phenoxy]sulfonylpropane-1-sulfonic acid |
| SMILES | CNc1cccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H9F6NO6S2/c1-17-6-3-2-4-7(5-6)23-25(21,22)10(15,16)8(11,12)9(13,14)24(18,19)20/h2-5,17H,1H3,(H,18,19,20) |
| InChIKey | ADQOKCSOBAHGCN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|