C14H10F3NO5S — CID 71328026
[3-[[2-(trifluoromethyl)benzoyl]amino]phenyl] hydrogen sulfate (PubChem CID 71328026) has the molecular formula C14H10F3NO5S and a molecular weight of 361.30 g/mol. Its IUPAC name is [3-[[2-(trifluoromethyl)benzoyl]amino]phenyl] hydrogen sulfate.
| Compound Name | [3-[[2-(trifluoromethyl)benzoyl]amino]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 71328026 |
| Molecular Formula | C14H10F3NO5S |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | [3-[[2-(trifluoromethyl)benzoyl]amino]phenyl] hydrogen sulfate |
| SMILES | O=C(Nc1cccc(OS(=O)(=O)O)c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H10F3NO5S/c15-14(16,17)12-7-2-1-6-11(12)13(19)18-9-4-3-5-10(8-9)23-24(20,21)22/h1-8H,(H,18,19)(H,20,21,22) |
| InChIKey | MULNYXJPVZGKCW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|