C19H18F3NO4 — CID 86195732
4-[3-[[2-(trifluoromethyl)benzoyl]amino]phenoxy]pentanoic acid (PubChem CID 86195732) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 4-[3-[[2-(trifluoromethyl)benzoyl]amino]phenoxy]pentanoic acid.
| Compound Name | 4-[3-[[2-(trifluoromethyl)benzoyl]amino]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 86195732 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-[3-[[2-(trifluoromethyl)benzoyl]amino]phenoxy]pentanoic acid |
| SMILES | CC(CCC(=O)O)Oc1cccc(NC(=O)c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3NO4/c1-12(9-10-17(24)25)27-14-6-4-5-13(11-14)23-18(26)15-7-2-3-8-16(15)19(20,21)22/h2-8,11-12H,9-10H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | COFDYISVPANWJS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |