C14H14F6O8S2 — CID 129035770
3-[4-(2,2-dimethylpropanoyloxy)phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 129035770) has the molecular formula C14H14F6O8S2 and a molecular weight of 488.38 g/mol. Its IUPAC name is 3-[4-(2,2-dimethylpropanoyloxy)phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-(2,2-dimethylpropanoyloxy)phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129035770 |
| Molecular Formula | C14H14F6O8S2 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | 3-[4-(2,2-dimethylpropanoyloxy)phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CC(C)(C)C(=O)Oc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H14F6O8S2/c1-11(2,3)10(21)27-8-4-6-9(7-5-8)28-30(25,26)14(19,20)12(15,16)13(17,18)29(22,23)24/h4-7H,1-3H3,(H,22,23,24) |
| InChIKey | KJXKXTRBCVXLKR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|