C14H13F6O8S2- — CID 123862992
1,1,2,2,3,3-hexafluoro-3-[4-(2-methylbutanoyloxy)phenoxy]sulfonylpropane-1-sulfonate (PubChem CID 123862992) has the molecular formula C14H13F6O8S2- and a molecular weight of 487.37 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-(2-methylbutanoyloxy)phenoxy]sulfonylpropane-1-sulfonate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-methylbutanoyloxy)phenoxy]sulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 123862992 |
| Molecular Formula | C14H13F6O8S2- |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-methylbutanoyloxy)phenoxy]sulfonylpropane-1-sulfonate |
| SMILES | CCC(C)C(=O)Oc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H14F6O8S2/c1-3-8(2)11(21)27-9-4-6-10(7-5-9)28-30(25,26)14(19,20)12(15,16)13(17,18)29(22,23)24/h4-8H,3H2,1-2H3,(H,22,23,24)/p-1 |
| InChIKey | ZIZXHLGTFHGBRH-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|