C16H16F9NO8S3 — CID 58363965
[4-(3-methyl-2-oxopentyl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate (PubChem CID 58363965) has the molecular formula C16H16F9NO8S3 and a molecular weight of 617.49 g/mol. Its IUPAC name is [4-(3-methyl-2-oxopentyl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate.
| Compound Name | [4-(3-methyl-2-oxopentyl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 58363965 |
| Molecular Formula | C16H16F9NO8S3 |
| Molecular Weight | 617.49 g/mol |
| Exact Mass | 616.99 |
| IUPAC Name | [4-(3-methyl-2-oxopentyl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate |
| SMILES | CCC(C)C(=O)Cc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F9NO8S3/c1-3-9(2)12(27)8-10-4-6-11(7-5-10)34-37(32,33)15(21,22)13(17,18)14(19,20)35(28,29)26-36(30,31)16(23,24)25/h4-7,9,26H,3,8H2,1-2H3 |
| InChIKey | UZEQCRJDMYQWAJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|