C12H8F9NO9S3 — CID 88543033
methyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate (PubChem CID 88543033) has the molecular formula C12H8F9NO9S3 and a molecular weight of 577.38 g/mol. Its IUPAC name is methyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate.
| Compound Name | methyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate |
|---|---|
| PubChem CID | 88543033 |
| Molecular Formula | C12H8F9NO9S3 |
| Molecular Weight | 577.38 g/mol |
| Exact Mass | 576.92 |
| IUPAC Name | methyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate |
| SMILES | COC(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H8F9NO9S3/c1-30-8(23)6-2-4-7(5-3-6)31-34(28,29)11(17,18)9(13,14)10(15,16)32(24,25)22-33(26,27)12(19,20)21/h2-5,22H,1H3 |
| InChIKey | WLUMPBYQEUDFBX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|