C13H9F9O5S — CID 10789614
ethyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate (PubChem CID 10789614) has the molecular formula C13H9F9O5S and a molecular weight of 448.26 g/mol. Its IUPAC name is ethyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate.
| Compound Name | ethyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 10789614 |
| Molecular Formula | C13H9F9O5S |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | ethyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate |
| SMILES | CCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H9F9O5S/c1-2-26-9(23)7-3-5-8(6-4-7)27-28(24,25)13(21,22)11(16,17)10(14,15)12(18,19)20/h3-6H,2H2,1H3 |
| InChIKey | NBKMVIZRRQEUBL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|