C11H9BrF4O3 — CID 154730109
ethyl 4-(1-bromo-1,2,2,2-tetrafluoroethoxy)benzoate (PubChem CID 154730109) has the molecular formula C11H9BrF4O3 and a molecular weight of 345.09 g/mol. Its IUPAC name is ethyl 4-(1-bromo-1,2,2,2-tetrafluoroethoxy)benzoate.
| Compound Name | ethyl 4-(1-bromo-1,2,2,2-tetrafluoroethoxy)benzoate |
|---|---|
| PubChem CID | 154730109 |
| Molecular Formula | C11H9BrF4O3 |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | ethyl 4-(1-bromo-1,2,2,2-tetrafluoroethoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(OC(F)(Br)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9BrF4O3/c1-2-18-9(17)7-3-5-8(6-4-7)19-10(12,13)11(14,15)16/h3-6H,2H2,1H3 |
| InChIKey | XXKOWUJKTKQDSF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|