C13H15F3O3 — CID 102390043
ethyl 4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoate (PubChem CID 102390043) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is ethyl 4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoate.
| Compound Name | ethyl 4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoate |
|---|---|
| PubChem CID | 102390043 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | ethyl 4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(C(O)(CC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O3/c1-3-12(18,13(14,15)16)10-7-5-9(6-8-10)11(17)19-4-2/h5-8,18H,3-4H2,1-2H3 |
| InChIKey | LNDNSDMDSJWDKZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |