C11H11F3O3 — CID 83959683
4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoic acid (PubChem CID 83959683) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoic acid.
| Compound Name | 4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 83959683 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)benzoic acid |
| SMILES | CCC(O)(c1ccc(C(=O)O)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O3/c1-2-10(17,11(12,13)14)8-5-3-7(4-6-8)9(15)16/h3-6,17H,2H2,1H3,(H,15,16) |
| InChIKey | WZKZOJOJTDZLPF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |