C10H9Cl2F3O — CID 83950177
2-(3,5-dichlorophenyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 83950177) has the molecular formula C10H9Cl2F3O and a molecular weight of 273.08 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 2-(3,5-dichlorophenyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 83950177 |
| Molecular Formula | C10H9Cl2F3O |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | CCC(O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H9Cl2F3O/c1-2-9(16,10(13,14)15)6-3-7(11)5-8(12)4-6/h3-5,16H,2H2,1H3 |
| InChIKey | ZNBCZLCVSRTKRT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |