C10H5Cl2F3O — CID 89415630
(2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 89415630) has the molecular formula C10H5Cl2F3O and a molecular weight of 269.05 g/mol. Its IUPAC name is (2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | (2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 89415630 |
| Molecular Formula | C10H5Cl2F3O |
| Molecular Weight | 269.05 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | (2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | C#C[C@](O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H5Cl2F3O/c1-2-9(16,10(13,14)15)6-3-7(11)5-8(12)4-6/h1,3-5,16H/t9-/m0/s1 |
| InChIKey | OVMQGWLOEADJCQ-VIFPVBQESA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.05 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|