C14H11Cl2F3O2 — CID 90342785
(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid (PubChem CID 90342785) has the molecular formula C14H11Cl2F3O2 and a molecular weight of 339.14 g/mol. Its IUPAC name is (5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid.
| Compound Name | (5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid |
|---|---|
| PubChem CID | 90342785 |
| Molecular Formula | C14H11Cl2F3O2 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | (5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid |
| SMILES | C#C[C@@](CCCC(=O)O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C14H11Cl2F3O2/c1-2-13(14(17,18)19,5-3-4-12(20)21)9-6-10(15)8-11(16)7-9/h1,6-8H,3-5H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | DVXSIIRXPDPMTR-CYBMUJFWSA-N |
| XLogP | 4.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|