C16H17Cl2NO4 — CID 57186636
5-cyano-5-(3,4-dichlorophenyl)nonanedioic acid (PubChem CID 57186636) has the molecular formula C16H17Cl2NO4 and a molecular weight of 358.22 g/mol. Its IUPAC name is 5-cyano-5-(3,4-dichlorophenyl)nonanedioic acid.
| Compound Name | 5-cyano-5-(3,4-dichlorophenyl)nonanedioic acid |
|---|---|
| PubChem CID | 57186636 |
| Molecular Formula | C16H17Cl2NO4 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 5-cyano-5-(3,4-dichlorophenyl)nonanedioic acid |
| SMILES | N#CC(CCCC(=O)O)(CCCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NO4/c17-12-6-5-11(9-13(12)18)16(10-19,7-1-3-14(20)21)8-2-4-15(22)23/h5-6,9H,1-4,7-8H2,(H,20,21)(H,22,23) |
| InChIKey | HZQGOSUEHONNAG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |