C17H18Cl2NO4- — CID 22376634
3-cyano-3-(3,4-dichlorophenyl)-5-(oxan-2-yloxy)pentanoate (PubChem CID 22376634) has the molecular formula C17H18Cl2NO4- and a molecular weight of 371.24 g/mol. Its IUPAC name is 3-cyano-3-(3,4-dichlorophenyl)-5-(oxan-2-yloxy)pentanoate.
| Compound Name | 3-cyano-3-(3,4-dichlorophenyl)-5-(oxan-2-yloxy)pentanoate |
|---|---|
| PubChem CID | 22376634 |
| Molecular Formula | C17H18Cl2NO4- |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 3-cyano-3-(3,4-dichlorophenyl)-5-(oxan-2-yloxy)pentanoate |
| SMILES | N#CC(CCOC1CCCCO1)(CC(=O)[O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2NO4/c18-13-5-4-12(9-14(13)19)17(11-20,10-15(21)22)6-8-24-16-3-1-2-7-23-16/h4-5,9,16H,1-3,6-8,10H2,(H,21,22)/p-1 |
| InChIKey | NMMKFHWQPRGEDN-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |