C15H17Cl2NO3 — CID 102273295
(Z)-3-amino-1-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)but-2-en-1-one (PubChem CID 102273295) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is (Z)-3-amino-1-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)but-2-en-1-one.
| Compound Name | (Z)-3-amino-1-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)but-2-en-1-one |
|---|---|
| PubChem CID | 102273295 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (Z)-3-amino-1-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)but-2-en-1-one |
| SMILES | N/C(=C\C(=O)c1ccc(Cl)c(Cl)c1)COC1CCCCO1 |
| InChI | InChI=1S/C15H17Cl2NO3/c16-12-5-4-10(7-13(12)17)14(19)8-11(18)9-21-15-3-1-2-6-20-15/h4-5,7-8,15H,1-3,6,9,18H2/b11-8- |
| InChIKey | LDENQLLEICREKN-FLIBITNWSA-N |
| XLogP | 3.56 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|