C19H23Cl2NO4 — CID 22376646
5-cyano-5-(3,4-dichlorophenyl)-7-(oxan-2-yloxy)heptanoic acid (PubChem CID 22376646) has the molecular formula C19H23Cl2NO4 and a molecular weight of 400.30 g/mol. Its IUPAC name is 5-cyano-5-(3,4-dichlorophenyl)-7-(oxan-2-yloxy)heptanoic acid.
| Compound Name | 5-cyano-5-(3,4-dichlorophenyl)-7-(oxan-2-yloxy)heptanoic acid |
|---|---|
| PubChem CID | 22376646 |
| Molecular Formula | C19H23Cl2NO4 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 5-cyano-5-(3,4-dichlorophenyl)-7-(oxan-2-yloxy)heptanoic acid |
| SMILES | N#CC(CCCC(=O)O)(CCOC1CCCCO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H23Cl2NO4/c20-15-7-6-14(12-16(15)21)19(13-22,8-3-4-17(23)24)9-11-26-18-5-1-2-10-25-18/h6-7,12,18H,1-5,8-11H2,(H,23,24) |
| InChIKey | YANGKGPMJYNKPE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |