C26H31Cl2NO3 — CID 54102650
[3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]piperidin-1-yl]-phenylmethanone (PubChem CID 54102650) has the molecular formula C26H31Cl2NO3 and a molecular weight of 476.44 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 54102650 |
| Molecular Formula | C26H31Cl2NO3 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCCC(CCCOC2CCCCO2)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C26H31Cl2NO3/c27-22-12-11-21(18-23(22)28)26(14-7-17-32-24-10-4-5-16-31-24)13-6-15-29(19-26)25(30)20-8-2-1-3-9-20/h1-3,8-9,11-12,18,24H,4-7,10,13-17,19H2 |
| InChIKey | NBOVYRMUEURBMM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|