C36H43Cl3N2O4 — CID 22741788
2-[1-[3-[1-benzoyl-3-(3,4-dichlorophenyl)piperidin-3-yl]propyl]-4-phenylpiperidin-4-yl]oxyethyl acetate;hydrochloride (PubChem CID 22741788) has the molecular formula C36H43Cl3N2O4 and a molecular weight of 674.11 g/mol. Its IUPAC name is 2-[1-[3-[1-benzoyl-3-(3,4-dichlorophenyl)piperidin-3-yl]propyl]-4-phenylpiperidin-4-yl]oxyethyl acetate;hydrochloride.
| Compound Name | 2-[1-[3-[1-benzoyl-3-(3,4-dichlorophenyl)piperidin-3-yl]propyl]-4-phenylpiperidin-4-yl]oxyethyl acetate;hydrochloride |
|---|---|
| PubChem CID | 22741788 |
| Molecular Formula | C36H43Cl3N2O4 |
| Molecular Weight | 674.11 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | 2-[1-[3-[1-benzoyl-3-(3,4-dichlorophenyl)piperidin-3-yl]propyl]-4-phenylpiperidin-4-yl]oxyethyl acetate;hydrochloride |
| SMILES | CC(=O)OCCOC1(c2ccccc2)CCN(CCCC2(c3ccc(Cl)c(Cl)c3)CCCN(C(=O)c3ccccc3)C2)CC1.Cl |
| InChI | InChI=1S/C36H42Cl2N2O4.ClH/c1-28(41)43-24-25-44-36(30-12-6-3-7-13-30)18-22-39(23-19-36)20-8-16-35(31-14-15-32(37)33(38)26-31)17-9-21-40(27-35)34(42)29-10-4-2-5-11-29;/h2-7,10-15,26H,8-9,16-25,27H2,1H3;1H |
| InChIKey | GQSKGWSAYUJNRK-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.11 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|